C20H13N3S — CID 59282860
5-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-1,3-benzothiazole (PubChem CID 59282860) has the molecular formula C20H13N3S and a molecular weight of 327.41 g/mol. Its IUPAC name is 5-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-1,3-benzothiazole.
| Compound Name | 5-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 59282860 |
| Molecular Formula | C20H13N3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 5-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-1,3-benzothiazole |
| SMILES | c1ccn2cc(-c3ccc(-c4ccc5scnc5c4)cc3)nc2c1 |
| InChI | InChI=1S/C20H13N3S/c1-2-10-23-12-18(22-20(23)3-1)15-6-4-14(5-7-15)16-8-9-19-17(11-16)21-13-24-19/h1-13H |
| InChIKey | JZTUZDNPGZLMMP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |