C22H19N3O2 — CID 121055747
N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)-2-phenoxyacetamide (PubChem CID 121055747) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)-2-phenoxyacetamide.
| Compound Name | N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)-2-phenoxyacetamide |
|---|---|
| PubChem CID | 121055747 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-(5-imidazo[1,2-a]pyridin-2-yl-2-methylphenyl)-2-phenoxyacetamide |
| SMILES | Cc1ccc(-c2cn3ccccc3n2)cc1NC(=O)COc1ccccc1 |
| InChI | InChI=1S/C22H19N3O2/c1-16-10-11-17(20-14-25-12-6-5-9-21(25)23-20)13-19(16)24-22(26)15-27-18-7-3-2-4-8-18/h2-14H,15H2,1H3,(H,24,26) |
| InChIKey | FSCYFPBVMLWIBN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |