C17H14Cl3N3O4 — CID 118893174
5-morpholin-4-yl-2-nitro-N-(3,4,5-trichlorophenyl)benzamide (PubChem CID 118893174) has the molecular formula C17H14Cl3N3O4 and a molecular weight of 430.68 g/mol. Its IUPAC name is 5-morpholin-4-yl-2-nitro-N-(3,4,5-trichlorophenyl)benzamide.
| Compound Name | 5-morpholin-4-yl-2-nitro-N-(3,4,5-trichlorophenyl)benzamide |
|---|---|
| PubChem CID | 118893174 |
| Molecular Formula | C17H14Cl3N3O4 |
| Molecular Weight | 430.68 g/mol |
| Exact Mass | 429.00 |
| IUPAC Name | 5-morpholin-4-yl-2-nitro-N-(3,4,5-trichlorophenyl)benzamide |
| SMILES | O=C(Nc1cc(Cl)c(Cl)c(Cl)c1)c1cc(N2CCOCC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14Cl3N3O4/c18-13-7-10(8-14(19)16(13)20)21-17(24)12-9-11(1-2-15(12)23(25)26)22-3-5-27-6-4-22/h1-2,7-9H,3-6H2,(H,21,24) |
| InChIKey | WLWGWVQVCSBLKZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.68 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|