C25H23N3O6 — CID 33130448
[(1S)-2-anilino-2-oxo-1-phenylethyl] 5-morpholin-4-yl-2-nitrobenzoate (PubChem CID 33130448) has the molecular formula C25H23N3O6 and a molecular weight of 461.47 g/mol. Its IUPAC name is [(1S)-2-anilino-2-oxo-1-phenylethyl] 5-morpholin-4-yl-2-nitrobenzoate.
| Compound Name | [(1S)-2-anilino-2-oxo-1-phenylethyl] 5-morpholin-4-yl-2-nitrobenzoate |
|---|---|
| PubChem CID | 33130448 |
| Molecular Formula | C25H23N3O6 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | [(1S)-2-anilino-2-oxo-1-phenylethyl] 5-morpholin-4-yl-2-nitrobenzoate |
| SMILES | O=C(O[C@H](C(=O)Nc1ccccc1)c1ccccc1)c1cc(N2CCOCC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H23N3O6/c29-24(26-19-9-5-2-6-10-19)23(18-7-3-1-4-8-18)34-25(30)21-17-20(11-12-22(21)28(31)32)27-13-15-33-16-14-27/h1-12,17,23H,13-16H2,(H,26,29)/t23-/m0/s1 |
| InChIKey | OILZGKQJBUWCBG-QHCPKHFHSA-N |
| XLogP | 3.97 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|