C21H13Cl3N2O5 — CID 25361943
[(1R)-2-(3,5-dichloroanilino)-2-oxo-1-phenylethyl] 5-chloro-2-nitrobenzoate (PubChem CID 25361943) has the molecular formula C21H13Cl3N2O5 and a molecular weight of 479.70 g/mol. Its IUPAC name is [(1R)-2-(3,5-dichloroanilino)-2-oxo-1-phenylethyl] 5-chloro-2-nitrobenzoate.
| Compound Name | [(1R)-2-(3,5-dichloroanilino)-2-oxo-1-phenylethyl] 5-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 25361943 |
| Molecular Formula | C21H13Cl3N2O5 |
| Molecular Weight | 479.70 g/mol |
| Exact Mass | 477.99 |
| IUPAC Name | [(1R)-2-(3,5-dichloroanilino)-2-oxo-1-phenylethyl] 5-chloro-2-nitrobenzoate |
| SMILES | O=C(O[C@@H](C(=O)Nc1cc(Cl)cc(Cl)c1)c1ccccc1)c1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H13Cl3N2O5/c22-13-6-7-18(26(29)30)17(11-13)21(28)31-19(12-4-2-1-3-5-12)20(27)25-16-9-14(23)8-15(24)10-16/h1-11,19H,(H,25,27)/t19-/m1/s1 |
| InChIKey | LNHZIEBGCIYNSR-LJQANCHMSA-N |
| XLogP | 6.09 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.70 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|