C27H25ClN2O7S — CID 2432184
ethyl (6S)-2-[[(2R)-2-(5-chloro-2-nitrobenzoyl)oxy-2-phenylacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 2432184) has the molecular formula C27H25ClN2O7S and a molecular weight of 557.02 g/mol. Its IUPAC name is ethyl (6S)-2-[[(2R)-2-(5-chloro-2-nitrobenzoyl)oxy-2-phenylacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl (6S)-2-[[(2R)-2-(5-chloro-2-nitrobenzoyl)oxy-2-phenylacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 2432184 |
| Molecular Formula | C27H25ClN2O7S |
| Molecular Weight | 557.02 g/mol |
| Exact Mass | 556.11 |
| IUPAC Name | ethyl (6S)-2-[[(2R)-2-(5-chloro-2-nitrobenzoyl)oxy-2-phenylacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)[C@H](OC(=O)c2cc(Cl)ccc2[N+](=O)[O-])c2ccccc2)sc2c1CC[C@H](C)C2 |
| InChI | InChI=1S/C27H25ClN2O7S/c1-3-36-27(33)22-18-11-9-15(2)13-21(18)38-25(22)29-24(31)23(16-7-5-4-6-8-16)37-26(32)19-14-17(28)10-12-20(19)30(34)35/h4-8,10,12,14-15,23H,3,9,11,13H2,1-2H3,(H,29,31)/t15-,23+/m0/s1 |
| InChIKey | UKQPTRJSJVQUNI-NPMXOYFQSA-N |
| XLogP | 6.15 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.02 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|