C33H31N3O6S2 — CID 18910665
ethyl 6-methyl-2-[[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 18910665) has the molecular formula C33H31N3O6S2 and a molecular weight of 629.76 g/mol. Its IUPAC name is ethyl 6-methyl-2-[[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 6-methyl-2-[[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 18910665 |
| Molecular Formula | C33H31N3O6S2 |
| Molecular Weight | 629.76 g/mol |
| Exact Mass | 629.17 |
| IUPAC Name | ethyl 6-methyl-2-[[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(Sc2cccc(NC(=O)c3cccc([N+](=O)[O-])c3)c2)c2ccccc2)sc2c1CCC(C)C2 |
| InChI | InChI=1S/C33H31N3O6S2/c1-3-42-33(39)28-26-16-15-20(2)17-27(26)44-32(28)35-31(38)29(21-9-5-4-6-10-21)43-25-14-8-12-23(19-25)34-30(37)22-11-7-13-24(18-22)36(40)41/h4-14,18-20,29H,3,15-17H2,1-2H3,(H,34,37)(H,35,38) |
| InChIKey | UCSLOFIIRQZUDW-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.76 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|