C35H35N3O6S2 — CID 18910666
methyl 6-tert-butyl-2-[[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 18910666) has the molecular formula C35H35N3O6S2 and a molecular weight of 657.81 g/mol. Its IUPAC name is methyl 6-tert-butyl-2-[[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 6-tert-butyl-2-[[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 18910666 |
| Molecular Formula | C35H35N3O6S2 |
| Molecular Weight | 657.81 g/mol |
| Exact Mass | 657.20 |
| IUPAC Name | methyl 6-tert-butyl-2-[[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C(Sc2cccc(NC(=O)c3cccc([N+](=O)[O-])c3)c2)c2ccccc2)sc2c1CCC(C(C)(C)C)C2 |
| InChI | InChI=1S/C35H35N3O6S2/c1-35(2,3)23-16-17-27-28(19-23)46-33(29(27)34(41)44-4)37-32(40)30(21-10-6-5-7-11-21)45-26-15-9-13-24(20-26)36-31(39)22-12-8-14-25(18-22)38(42)43/h5-15,18,20,23,30H,16-17,19H2,1-4H3,(H,36,39)(H,37,40) |
| InChIKey | ZFAZTDQMHFKCGG-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.81 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|