C18H16ClN3O6 — CID 8604079
[(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 5-chloro-2-nitrobenzoate (PubChem CID 8604079) has the molecular formula C18H16ClN3O6 and a molecular weight of 405.79 g/mol. Its IUPAC name is [(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 5-chloro-2-nitrobenzoate.
| Compound Name | [(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 5-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 8604079 |
| Molecular Formula | C18H16ClN3O6 |
| Molecular Weight | 405.79 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | [(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 5-chloro-2-nitrobenzoate |
| SMILES | CCNC(=O)NC(=O)[C@@H](OC(=O)c1cc(Cl)ccc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C18H16ClN3O6/c1-2-20-18(25)21-16(23)15(11-6-4-3-5-7-11)28-17(24)13-10-12(19)8-9-14(13)22(26)27/h3-10,15H,2H2,1H3,(H2,20,21,23,25)/t15-/m0/s1 |
| InChIKey | TYVNGFVSXIQPBQ-HNNXBMFYSA-N |
| XLogP | 2.99 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.79 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|