C21H21N3O8 — CID 55313095
1-O-ethyl 3-O-[2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 5-nitrobenzene-1,3-dicarboxylate (PubChem CID 55313095) has the molecular formula C21H21N3O8 and a molecular weight of 443.41 g/mol. Its IUPAC name is 1-O-ethyl 3-O-[2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 5-nitrobenzene-1,3-dicarboxylate.
| Compound Name | 1-O-ethyl 3-O-[2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 5-nitrobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 55313095 |
| Molecular Formula | C21H21N3O8 |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 1-O-ethyl 3-O-[2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 5-nitrobenzene-1,3-dicarboxylate |
| SMILES | CCNC(=O)NC(=O)C(OC(=O)c1cc(C(=O)OCC)cc([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C21H21N3O8/c1-3-22-21(28)23-18(25)17(13-8-6-5-7-9-13)32-20(27)15-10-14(19(26)31-4-2)11-16(12-15)24(29)30/h5-12,17H,3-4H2,1-2H3,(H2,22,23,25,28) |
| InChIKey | CNRAZOKSJBOELC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 153.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|