C19H17F3N2O4 — CID 7838955
[(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 3-(trifluoromethyl)benzoate (PubChem CID 7838955) has the molecular formula C19H17F3N2O4 and a molecular weight of 394.35 g/mol. Its IUPAC name is [(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 3-(trifluoromethyl)benzoate.
| Compound Name | [(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 7838955 |
| Molecular Formula | C19H17F3N2O4 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | [(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 3-(trifluoromethyl)benzoate |
| SMILES | CCNC(=O)NC(=O)[C@H](OC(=O)c1cccc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C19H17F3N2O4/c1-2-23-18(27)24-16(25)15(12-7-4-3-5-8-12)28-17(26)13-9-6-10-14(11-13)19(20,21)22/h3-11,15H,2H2,1H3,(H2,23,24,25,27)/t15-/m1/s1 |
| InChIKey | YFHMOELOBWCWDP-OAHLLOKOSA-N |
| XLogP | 3.45 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |