C18H18F3N3O2 — CID 40794821
(2R)-N-(ethylcarbamoyl)-2-phenyl-2-[3-(trifluoromethyl)anilino]acetamide (PubChem CID 40794821) has the molecular formula C18H18F3N3O2 and a molecular weight of 365.36 g/mol. Its IUPAC name is (2R)-N-(ethylcarbamoyl)-2-phenyl-2-[3-(trifluoromethyl)anilino]acetamide.
| Compound Name | (2R)-N-(ethylcarbamoyl)-2-phenyl-2-[3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 40794821 |
| Molecular Formula | C18H18F3N3O2 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | (2R)-N-(ethylcarbamoyl)-2-phenyl-2-[3-(trifluoromethyl)anilino]acetamide |
| SMILES | CCNC(=O)NC(=O)[C@H](Nc1cccc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C18H18F3N3O2/c1-2-22-17(26)24-16(25)15(12-7-4-3-5-8-12)23-14-10-6-9-13(11-14)18(19,20)21/h3-11,15,23H,2H2,1H3,(H2,22,24,25,26)/t15-/m1/s1 |
| InChIKey | FMIDJOUHMBFEOM-OAHLLOKOSA-N |
| XLogP | 3.70 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |