C24H22F3N3O3 — CID 60542528
ethyl N-[4-[[2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl]amino]phenyl]carbamate (PubChem CID 60542528) has the molecular formula C24H22F3N3O3 and a molecular weight of 457.45 g/mol. Its IUPAC name is ethyl N-[4-[[2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl]amino]phenyl]carbamate.
| Compound Name | ethyl N-[4-[[2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 60542528 |
| Molecular Formula | C24H22F3N3O3 |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | ethyl N-[4-[[2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl]amino]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NC(C(=O)Nc2cccc(C(F)(F)F)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H22F3N3O3/c1-2-33-23(32)30-19-13-11-18(12-14-19)28-21(16-7-4-3-5-8-16)22(31)29-20-10-6-9-17(15-20)24(25,26)27/h3-15,21,28H,2H2,1H3,(H,29,31)(H,30,32) |
| InChIKey | ROESPHFHCSHQGY-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |