C18H17F3N2O3 — CID 4013738
ethyl N-[2-oxo-2-phenyl-1-[3-(trifluoromethyl)anilino]ethyl]carbamate (PubChem CID 4013738) has the molecular formula C18H17F3N2O3 and a molecular weight of 366.34 g/mol. Its IUPAC name is ethyl N-[2-oxo-2-phenyl-1-[3-(trifluoromethyl)anilino]ethyl]carbamate.
| Compound Name | ethyl N-[2-oxo-2-phenyl-1-[3-(trifluoromethyl)anilino]ethyl]carbamate |
|---|---|
| PubChem CID | 4013738 |
| Molecular Formula | C18H17F3N2O3 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | ethyl N-[2-oxo-2-phenyl-1-[3-(trifluoromethyl)anilino]ethyl]carbamate |
| SMILES | CCOC(=O)NC(Nc1cccc(C(F)(F)F)c1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H17F3N2O3/c1-2-26-17(25)23-16(15(24)12-7-4-3-5-8-12)22-14-10-6-9-13(11-14)18(19,20)21/h3-11,16,22H,2H2,1H3,(H,23,25) |
| InChIKey | BGVLWBSWEZWZDK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|