C23H20F3N3O3 — CID 55598567
2-[4-(2-amino-2-oxoethoxy)anilino]-2-phenyl-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 55598567) has the molecular formula C23H20F3N3O3 and a molecular weight of 443.43 g/mol. Its IUPAC name is 2-[4-(2-amino-2-oxoethoxy)anilino]-2-phenyl-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-(2-amino-2-oxoethoxy)anilino]-2-phenyl-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 55598567 |
| Molecular Formula | C23H20F3N3O3 |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 2-[4-(2-amino-2-oxoethoxy)anilino]-2-phenyl-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | NC(=O)COc1ccc(NC(C(=O)Nc2cccc(C(F)(F)F)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20F3N3O3/c24-23(25,26)16-7-4-8-18(13-16)29-22(31)21(15-5-2-1-3-6-15)28-17-9-11-19(12-10-17)32-14-20(27)30/h1-13,21,28H,14H2,(H2,27,30)(H,29,31) |
| InChIKey | BSEGDGYNZNZOKB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|