C20H21ClN2O5 — CID 7787396
[(2S)-1-[2-[(2R)-butan-2-yl]anilino]-1-oxopropan-2-yl] 5-chloro-2-nitrobenzoate (PubChem CID 7787396) has the molecular formula C20H21ClN2O5 and a molecular weight of 404.85 g/mol. Its IUPAC name is [(2S)-1-[2-[(2R)-butan-2-yl]anilino]-1-oxopropan-2-yl] 5-chloro-2-nitrobenzoate.
| Compound Name | [(2S)-1-[2-[(2R)-butan-2-yl]anilino]-1-oxopropan-2-yl] 5-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 7787396 |
| Molecular Formula | C20H21ClN2O5 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | [(2S)-1-[2-[(2R)-butan-2-yl]anilino]-1-oxopropan-2-yl] 5-chloro-2-nitrobenzoate |
| SMILES | CC[C@@H](C)c1ccccc1NC(=O)[C@H](C)OC(=O)c1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H21ClN2O5/c1-4-12(2)15-7-5-6-8-17(15)22-19(24)13(3)28-20(25)16-11-14(21)9-10-18(16)23(26)27/h5-13H,4H2,1-3H3,(H,22,24)/t12-,13+/m1/s1 |
| InChIKey | BLWDCONTKZXSSI-OLZOCXBDSA-N |
| XLogP | 4.95 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|