C21H24N2O5S — CID 7678417
[(2S)-1-[2-[(2S)-butan-2-yl]anilino]-1-oxopropan-2-yl] 4-methylsulfanyl-3-nitrobenzoate (PubChem CID 7678417) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is [(2S)-1-[2-[(2S)-butan-2-yl]anilino]-1-oxopropan-2-yl] 4-methylsulfanyl-3-nitrobenzoate.
| Compound Name | [(2S)-1-[2-[(2S)-butan-2-yl]anilino]-1-oxopropan-2-yl] 4-methylsulfanyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 7678417 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | [(2S)-1-[2-[(2S)-butan-2-yl]anilino]-1-oxopropan-2-yl] 4-methylsulfanyl-3-nitrobenzoate |
| SMILES | CC[C@H](C)c1ccccc1NC(=O)[C@H](C)OC(=O)c1ccc(SC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H24N2O5S/c1-5-13(2)16-8-6-7-9-17(16)22-20(24)14(3)28-21(25)15-10-11-19(29-4)18(12-15)23(26)27/h6-14H,5H2,1-4H3,(H,22,24)/t13-,14-/m0/s1 |
| InChIKey | JRSOHDRNVILTJA-KBPBESRZSA-N |
| XLogP | 5.01 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|