C43H46K2N4O8S — CID 140701779
dipotassium;4-[2-[4-[[2-[[3-[(4-carboxylatocyclohexyl)-ethylsulfamoyl]benzoyl]amino]-5-piperidin-1-ylbenzoyl]amino]phenyl]ethyl]benzoate (PubChem CID 140701779) has the molecular formula C43H46K2N4O8S and a molecular weight of 857.12 g/mol. Its IUPAC name is dipotassium;4-[2-[4-[[2-[[3-[(4-carboxylatocyclohexyl)-ethylsulfamoyl]benzoyl]amino]-5-piperidin-1-ylbenzoyl]amino]phenyl]ethyl]benzoate.
| Compound Name | dipotassium;4-[2-[4-[[2-[[3-[(4-carboxylatocyclohexyl)-ethylsulfamoyl]benzoyl]amino]-5-piperidin-1-ylbenzoyl]amino]phenyl]ethyl]benzoate |
|---|---|
| PubChem CID | 140701779 |
| Molecular Formula | C43H46K2N4O8S |
| Molecular Weight | 857.12 g/mol |
| Exact Mass | 856.23 |
| IUPAC Name | dipotassium;4-[2-[4-[[2-[[3-[(4-carboxylatocyclohexyl)-ethylsulfamoyl]benzoyl]amino]-5-piperidin-1-ylbenzoyl]amino]phenyl]ethyl]benzoate |
| SMILES | CCN(C1CCC(C(=O)[O-])CC1)S(=O)(=O)c1cccc(C(=O)Nc2ccc(N3CCCCC3)cc2C(=O)Nc2ccc(CCc3ccc(C(=O)[O-])cc3)cc2)c1.[K+].[K+] |
| InChI | InChI=1S/C43H48N4O8S.2K/c1-2-47(35-21-17-32(18-22-35)43(52)53)56(54,55)37-8-6-7-33(27-37)40(48)45-39-24-23-36(46-25-4-3-5-26-46)28-38(39)41(49)44-34-19-13-30(14-20-34)10-9-29-11-15-31(16-12-29)42(50)51;;/h6-8,11-16,19-20,23-24,27-28,32,35H,2-5,9-10,17-18,21-22,25-26H2,1H3,(H,44,49)(H,45,48)(H,50,51)(H,52,53);;/q;2*+1/p-2 |
| InChIKey | FAWGFMNSLKZLRN-UHFFFAOYSA-L |
| XLogP | -1.34 |
| TPSA | 179.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.12 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |