C43H46I2N4O7S — CID 129269022
iodo 4-[2-[4-[[2-[[3-[ethyl-(4-iodooxycarbonylcyclohexyl)sulfinamoyl]benzoyl]amino]-5-piperidin-1-ylbenzoyl]amino]phenyl]ethyl]benzoate (PubChem CID 129269022) has the molecular formula C43H46I2N4O7S and a molecular weight of 1016.74 g/mol. Its IUPAC name is iodo 4-[2-[4-[[2-[[3-[ethyl-(4-iodooxycarbonylcyclohexyl)sulfinamoyl]benzoyl]amino]-5-piperidin-1-ylbenzoyl]amino]phenyl]ethyl]benzoate.
| Compound Name | iodo 4-[2-[4-[[2-[[3-[ethyl-(4-iodooxycarbonylcyclohexyl)sulfinamoyl]benzoyl]amino]-5-piperidin-1-ylbenzoyl]amino]phenyl]ethyl]benzoate |
|---|---|
| PubChem CID | 129269022 |
| Molecular Formula | C43H46I2N4O7S |
| Molecular Weight | 1016.74 g/mol |
| Exact Mass | 1016.12 |
| IUPAC Name | iodo 4-[2-[4-[[2-[[3-[ethyl-(4-iodooxycarbonylcyclohexyl)sulfinamoyl]benzoyl]amino]-5-piperidin-1-ylbenzoyl]amino]phenyl]ethyl]benzoate |
| SMILES | CCN(C1CCC(C(=O)OI)CC1)S(=O)c1cccc(C(=O)Nc2ccc(N3CCCCC3)cc2C(=O)Nc2ccc(CCc3ccc(C(=O)OI)cc3)cc2)c1 |
| InChI | InChI=1S/C43H46I2N4O7S/c1-2-49(35-21-17-32(18-22-35)43(53)56-45)57(54)37-8-6-7-33(27-37)40(50)47-39-24-23-36(48-25-4-3-5-26-48)28-38(39)41(51)46-34-19-13-30(14-20-34)10-9-29-11-15-31(16-12-29)42(52)55-44/h6-8,11-16,19-20,23-24,27-28,32,35H,2-5,9-10,17-18,21-22,25-26H2,1H3,(H,46,51)(H,47,50) |
| InChIKey | HFRKIIMVYCVBIX-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1016.74 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|