C41H45N3O5S — CID 144737331
4-[2-[4-[[2-[[3-[cyclohexyl(ethyl)amino]sulfanylbenzoyl]amino]-5-(cyclopropylmethoxy)benzoyl]amino]phenyl]ethyl]benzoic acid (PubChem CID 144737331) has the molecular formula C41H45N3O5S and a molecular weight of 691.89 g/mol. Its IUPAC name is 4-[2-[4-[[2-[[3-[cyclohexyl(ethyl)amino]sulfanylbenzoyl]amino]-5-(cyclopropylmethoxy)benzoyl]amino]phenyl]ethyl]benzoic acid.
| Compound Name | 4-[2-[4-[[2-[[3-[cyclohexyl(ethyl)amino]sulfanylbenzoyl]amino]-5-(cyclopropylmethoxy)benzoyl]amino]phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 144737331 |
| Molecular Formula | C41H45N3O5S |
| Molecular Weight | 691.89 g/mol |
| Exact Mass | 691.31 |
| IUPAC Name | 4-[2-[4-[[2-[[3-[cyclohexyl(ethyl)amino]sulfanylbenzoyl]amino]-5-(cyclopropylmethoxy)benzoyl]amino]phenyl]ethyl]benzoic acid |
| SMILES | CCN(Sc1cccc(C(=O)Nc2ccc(OCC3CC3)cc2C(=O)Nc2ccc(CCc3ccc(C(=O)O)cc3)cc2)c1)C1CCCCC1 |
| InChI | InChI=1S/C41H45N3O5S/c1-2-44(34-8-4-3-5-9-34)50-36-10-6-7-32(25-36)39(45)43-38-24-23-35(49-27-30-13-14-30)26-37(38)40(46)42-33-21-17-29(18-22-33)12-11-28-15-19-31(20-16-28)41(47)48/h6-7,10,15-26,30,34H,2-5,8-9,11-14,27H2,1H3,(H,42,46)(H,43,45)(H,47,48) |
| InChIKey | NGZOXPZBMOCJSO-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.89 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|