C27H28N2O4 — CID 118863680
methyl 4-[2-[4-[[2-amino-5-(cyclopropylmethoxy)benzoyl]amino]phenyl]ethyl]benzoate (PubChem CID 118863680) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is methyl 4-[2-[4-[[2-amino-5-(cyclopropylmethoxy)benzoyl]amino]phenyl]ethyl]benzoate.
| Compound Name | methyl 4-[2-[4-[[2-amino-5-(cyclopropylmethoxy)benzoyl]amino]phenyl]ethyl]benzoate |
|---|---|
| PubChem CID | 118863680 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | methyl 4-[2-[4-[[2-amino-5-(cyclopropylmethoxy)benzoyl]amino]phenyl]ethyl]benzoate |
| SMILES | COC(=O)c1ccc(CCc2ccc(NC(=O)c3cc(OCC4CC4)ccc3N)cc2)cc1 |
| InChI | InChI=1S/C27H28N2O4/c1-32-27(31)21-10-6-18(7-11-21)2-3-19-8-12-22(13-9-19)29-26(30)24-16-23(14-15-25(24)28)33-17-20-4-5-20/h6-16,20H,2-5,17,28H2,1H3,(H,29,30) |
| InChIKey | UPRJMLSSNCQQEW-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|