C18H21ClN2O3 — CID 119421075
N-(2-amino-5-methoxyphenyl)-4-(cyclopropylmethoxy)benzamide;hydrochloride (PubChem CID 119421075) has the molecular formula C18H21ClN2O3 and a molecular weight of 348.83 g/mol. Its IUPAC name is N-(2-amino-5-methoxyphenyl)-4-(cyclopropylmethoxy)benzamide;hydrochloride.
| Compound Name | N-(2-amino-5-methoxyphenyl)-4-(cyclopropylmethoxy)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119421075 |
| Molecular Formula | C18H21ClN2O3 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | N-(2-amino-5-methoxyphenyl)-4-(cyclopropylmethoxy)benzamide;hydrochloride |
| SMILES | COc1ccc(N)c(NC(=O)c2ccc(OCC3CC3)cc2)c1.Cl |
| InChI | InChI=1S/C18H20N2O3.ClH/c1-22-15-8-9-16(19)17(10-15)20-18(21)13-4-6-14(7-5-13)23-11-12-2-3-12;/h4-10,12H,2-3,11,19H2,1H3,(H,20,21);1H |
| InChIKey | KOSCFWCVTSPUQH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|