C12H17ClN2O2 — CID 119421373
N-(2-amino-5-methoxyphenyl)cyclobutanecarboxamide;hydrochloride (PubChem CID 119421373) has the molecular formula C12H17ClN2O2 and a molecular weight of 256.73 g/mol. Its IUPAC name is N-(2-amino-5-methoxyphenyl)cyclobutanecarboxamide;hydrochloride.
| Compound Name | N-(2-amino-5-methoxyphenyl)cyclobutanecarboxamide;hydrochloride |
|---|---|
| PubChem CID | 119421373 |
| Molecular Formula | C12H17ClN2O2 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | N-(2-amino-5-methoxyphenyl)cyclobutanecarboxamide;hydrochloride |
| SMILES | COc1ccc(N)c(NC(=O)C2CCC2)c1.Cl |
| InChI | InChI=1S/C12H16N2O2.ClH/c1-16-9-5-6-10(13)11(7-9)14-12(15)8-3-2-4-8;/h5-8H,2-4,13H2,1H3,(H,14,15);1H |
| InChIKey | LXQSNVKWPLCALJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|