C20H30ClN3O3 — CID 119421456
N-(2-amino-5-methoxyphenyl)-4-(cyclopentanecarbonylamino)cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119421456) has the molecular formula C20H30ClN3O3 and a molecular weight of 395.93 g/mol. Its IUPAC name is N-(2-amino-5-methoxyphenyl)-4-(cyclopentanecarbonylamino)cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | N-(2-amino-5-methoxyphenyl)-4-(cyclopentanecarbonylamino)cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119421456 |
| Molecular Formula | C20H30ClN3O3 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | N-(2-amino-5-methoxyphenyl)-4-(cyclopentanecarbonylamino)cyclohexane-1-carboxamide;hydrochloride |
| SMILES | COc1ccc(N)c(NC(=O)C2CCC(NC(=O)C3CCCC3)CC2)c1.Cl |
| InChI | InChI=1S/C20H29N3O3.ClH/c1-26-16-10-11-17(21)18(12-16)23-20(25)14-6-8-15(9-7-14)22-19(24)13-4-2-3-5-13;/h10-15H,2-9,21H2,1H3,(H,22,24)(H,23,25);1H |
| InChIKey | XWCYKZKXSZNHCG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|