C12H16N2O2 — CID 16774141
N-(2-amino-4-methoxyphenyl)cyclobutanecarboxamide (PubChem CID 16774141) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is N-(2-amino-4-methoxyphenyl)cyclobutanecarboxamide.
| Compound Name | N-(2-amino-4-methoxyphenyl)cyclobutanecarboxamide |
|---|---|
| PubChem CID | 16774141 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N-(2-amino-4-methoxyphenyl)cyclobutanecarboxamide |
| SMILES | COc1ccc(NC(=O)C2CCC2)c(N)c1 |
| InChI | InChI=1S/C12H16N2O2/c1-16-9-5-6-11(10(13)7-9)14-12(15)8-3-2-4-8/h5-8H,2-4,13H2,1H3,(H,14,15) |
| InChIKey | RGMXORQKJKNJLY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|