C18H27ClN2O2 — CID 120988721
9-amino-N-(4-methoxy-2-methylphenyl)bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride (PubChem CID 120988721) has the molecular formula C18H27ClN2O2 and a molecular weight of 338.88 g/mol. Its IUPAC name is 9-amino-N-(4-methoxy-2-methylphenyl)bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride.
| Compound Name | 9-amino-N-(4-methoxy-2-methylphenyl)bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120988721 |
| Molecular Formula | C18H27ClN2O2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 9-amino-N-(4-methoxy-2-methylphenyl)bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride |
| SMILES | COc1ccc(NC(=O)C2CC3CCCC(C2)C3N)c(C)c1.Cl |
| InChI | InChI=1S/C18H26N2O2.ClH/c1-11-8-15(22-2)6-7-16(11)20-18(21)14-9-12-4-3-5-13(10-14)17(12)19;/h6-8,12-14,17H,3-5,9-10,19H2,1-2H3,(H,20,21);1H |
| InChIKey | NUVAXCYFXPGCJP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |