C19H28ClN3O2 — CID 119422541
N-(2-aminophenyl)-4-(cyclopentanecarbonylamino)cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119422541) has the molecular formula C19H28ClN3O2 and a molecular weight of 365.91 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-(cyclopentanecarbonylamino)cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | N-(2-aminophenyl)-4-(cyclopentanecarbonylamino)cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119422541 |
| Molecular Formula | C19H28ClN3O2 |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | N-(2-aminophenyl)-4-(cyclopentanecarbonylamino)cyclohexane-1-carboxamide;hydrochloride |
| SMILES | Cl.Nc1ccccc1NC(=O)C1CCC(NC(=O)C2CCCC2)CC1 |
| InChI | InChI=1S/C19H27N3O2.ClH/c20-16-7-3-4-8-17(16)22-19(24)14-9-11-15(12-10-14)21-18(23)13-5-1-2-6-13;/h3-4,7-8,13-15H,1-2,5-6,9-12,20H2,(H,21,23)(H,22,24);1H |
| InChIKey | JEEDCYJOHBLXJQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|