C19H23ClN4O2 — CID 119422273
3-N-(2-aminophenyl)-1-N-phenylpiperidine-1,3-dicarboxamide;hydrochloride (PubChem CID 119422273) has the molecular formula C19H23ClN4O2 and a molecular weight of 374.87 g/mol. Its IUPAC name is 3-N-(2-aminophenyl)-1-N-phenylpiperidine-1,3-dicarboxamide;hydrochloride.
| Compound Name | 3-N-(2-aminophenyl)-1-N-phenylpiperidine-1,3-dicarboxamide;hydrochloride |
|---|---|
| PubChem CID | 119422273 |
| Molecular Formula | C19H23ClN4O2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 3-N-(2-aminophenyl)-1-N-phenylpiperidine-1,3-dicarboxamide;hydrochloride |
| SMILES | Cl.Nc1ccccc1NC(=O)C1CCCN(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C19H22N4O2.ClH/c20-16-10-4-5-11-17(16)22-18(24)14-7-6-12-23(13-14)19(25)21-15-8-2-1-3-9-15;/h1-5,8-11,14H,6-7,12-13,20H2,(H,21,25)(H,22,24);1H |
| InChIKey | AGICOIGROHEUBO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|