C27H30N2O3S — CID 90377635
methyl 4-[2-[4-[(2-amino-5-cyclohexylthiophene-3-carbonyl)amino]phenyl]ethyl]benzoate (PubChem CID 90377635) has the molecular formula C27H30N2O3S and a molecular weight of 462.62 g/mol. Its IUPAC name is methyl 4-[2-[4-[(2-amino-5-cyclohexylthiophene-3-carbonyl)amino]phenyl]ethyl]benzoate.
| Compound Name | methyl 4-[2-[4-[(2-amino-5-cyclohexylthiophene-3-carbonyl)amino]phenyl]ethyl]benzoate |
|---|---|
| PubChem CID | 90377635 |
| Molecular Formula | C27H30N2O3S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | methyl 4-[2-[4-[(2-amino-5-cyclohexylthiophene-3-carbonyl)amino]phenyl]ethyl]benzoate |
| SMILES | COC(=O)c1ccc(CCc2ccc(NC(=O)c3cc(C4CCCCC4)sc3N)cc2)cc1 |
| InChI | InChI=1S/C27H30N2O3S/c1-32-27(31)21-13-9-18(10-14-21)7-8-19-11-15-22(16-12-19)29-26(30)23-17-24(33-25(23)28)20-5-3-2-4-6-20/h9-17,20H,2-8,28H2,1H3,(H,29,30) |
| InChIKey | WLSAUPCJEQTWAR-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |