C42H54O9 — CID 174840295
cyclobutane;3-(cyclohexylmethoxy)benzoic acid;bis(4-cyclopentyloxybenzoic acid) (PubChem CID 174840295) has the molecular formula C42H54O9 and a molecular weight of 702.89 g/mol. Its IUPAC name is cyclobutane;3-(cyclohexylmethoxy)benzoic acid;bis(4-cyclopentyloxybenzoic acid).
| Compound Name | cyclobutane;3-(cyclohexylmethoxy)benzoic acid;bis(4-cyclopentyloxybenzoic acid) |
|---|---|
| PubChem CID | 174840295 |
| Molecular Formula | C42H54O9 |
| Molecular Weight | 702.89 g/mol |
| Exact Mass | 702.38 |
| IUPAC Name | cyclobutane;3-(cyclohexylmethoxy)benzoic acid;bis(4-cyclopentyloxybenzoic acid) |
| SMILES | C1CCC1.O=C(O)c1ccc(OC2CCCC2)cc1.O=C(O)c1ccc(OC2CCCC2)cc1.O=C(O)c1cccc(OCC2CCCCC2)c1 |
| InChI | InChI=1S/C14H18O3.2C12H14O3.C4H8/c15-14(16)12-7-4-8-13(9-12)17-10-11-5-2-1-3-6-11;2*13-12(14)9-5-7-11(8-6-9)15-10-3-1-2-4-10;1-2-4-3-1/h4,7-9,11H,1-3,5-6,10H2,(H,15,16);2*5-8,10H,1-4H2,(H,13,14);1-4H2 |
| InChIKey | DAFRUTKYXWOFOT-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.89 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |