C19H26O3 — CID 158607530
1-[3-(cyclohexylmethoxy)phenyl]hexane-1,5-dione (PubChem CID 158607530) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is 1-[3-(cyclohexylmethoxy)phenyl]hexane-1,5-dione.
| Compound Name | 1-[3-(cyclohexylmethoxy)phenyl]hexane-1,5-dione |
|---|---|
| PubChem CID | 158607530 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 1-[3-(cyclohexylmethoxy)phenyl]hexane-1,5-dione |
| SMILES | CC(=O)CCCC(=O)c1cccc(OCC2CCCCC2)c1 |
| InChI | InChI=1S/C19H26O3/c1-15(20)7-5-12-19(21)17-10-6-11-18(13-17)22-14-16-8-3-2-4-9-16/h6,10-11,13,16H,2-5,7-9,12,14H2,1H3 |
| InChIKey | PAAQQPCBFMWDHC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |