C40H45N3O6S — CID 129269023
4-[2-[4-[[2-[[3-(3-carboxyhexylsulfanyl)benzoyl]amino]-5-(diethylamino)benzoyl]amino]phenyl]ethyl]benzoic acid (PubChem CID 129269023) has the molecular formula C40H45N3O6S and a molecular weight of 695.88 g/mol. Its IUPAC name is 4-[2-[4-[[2-[[3-(3-carboxyhexylsulfanyl)benzoyl]amino]-5-(diethylamino)benzoyl]amino]phenyl]ethyl]benzoic acid.
| Compound Name | 4-[2-[4-[[2-[[3-(3-carboxyhexylsulfanyl)benzoyl]amino]-5-(diethylamino)benzoyl]amino]phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 129269023 |
| Molecular Formula | C40H45N3O6S |
| Molecular Weight | 695.88 g/mol |
| Exact Mass | 695.30 |
| IUPAC Name | 4-[2-[4-[[2-[[3-(3-carboxyhexylsulfanyl)benzoyl]amino]-5-(diethylamino)benzoyl]amino]phenyl]ethyl]benzoic acid |
| SMILES | CCCC(CCSc1cccc(C(=O)Nc2ccc(N(CC)CC)cc2C(=O)Nc2ccc(CCc3ccc(C(=O)O)cc3)cc2)c1)C(=O)O |
| InChI | InChI=1S/C40H45N3O6S/c1-4-8-29(39(46)47)23-24-50-34-10-7-9-31(25-34)37(44)42-36-22-21-33(43(5-2)6-3)26-35(36)38(45)41-32-19-15-28(16-20-32)12-11-27-13-17-30(18-14-27)40(48)49/h7,9-10,13-22,25-26,29H,4-6,8,11-12,23-24H2,1-3H3,(H,41,45)(H,42,44)(H,46,47)(H,48,49) |
| InChIKey | CZWFRFVNVSSRMR-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.88 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |