C26H21N3O2S2 — CID 2446842
2-(3-phenothiazin-10-ylpropanoylamino)-5-phenylthiophene-3-carboxamide (PubChem CID 2446842) has the molecular formula C26H21N3O2S2 and a molecular weight of 471.61 g/mol. Its IUPAC name is 2-(3-phenothiazin-10-ylpropanoylamino)-5-phenylthiophene-3-carboxamide.
| Compound Name | 2-(3-phenothiazin-10-ylpropanoylamino)-5-phenylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 2446842 |
| Molecular Formula | C26H21N3O2S2 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 2-(3-phenothiazin-10-ylpropanoylamino)-5-phenylthiophene-3-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccccc2)sc1NC(=O)CCN1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C26H21N3O2S2/c27-25(31)18-16-23(17-8-2-1-3-9-17)33-26(18)28-24(30)14-15-29-19-10-4-6-12-21(19)32-22-13-7-5-11-20(22)29/h1-13,16H,14-15H2,(H2,27,31)(H,28,30) |
| InChIKey | BXJNWURIOMCEAV-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|