C23H19N5OS — CID 112835297
3-phenothiazin-10-yl-N-[2-(triazol-1-yl)phenyl]propanamide (PubChem CID 112835297) has the molecular formula C23H19N5OS and a molecular weight of 413.51 g/mol. Its IUPAC name is 3-phenothiazin-10-yl-N-[2-(triazol-1-yl)phenyl]propanamide.
| Compound Name | 3-phenothiazin-10-yl-N-[2-(triazol-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 112835297 |
| Molecular Formula | C23H19N5OS |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 3-phenothiazin-10-yl-N-[2-(triazol-1-yl)phenyl]propanamide |
| SMILES | O=C(CCN1c2ccccc2Sc2ccccc21)Nc1ccccc1-n1ccnn1 |
| InChI | InChI=1S/C23H19N5OS/c29-23(25-17-7-1-2-8-18(17)28-16-14-24-26-28)13-15-27-19-9-3-5-11-21(19)30-22-12-6-4-10-20(22)27/h1-12,14,16H,13,15H2,(H,25,29) |
| InChIKey | NFVLTVHHGZACNP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|