C11H8F4N4O — CID 103737699
2,2,3,3-tetrafluoro-N-[2-(triazol-1-yl)phenyl]propanamide (PubChem CID 103737699) has the molecular formula C11H8F4N4O and a molecular weight of 288.20 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[2-(triazol-1-yl)phenyl]propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[2-(triazol-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 103737699 |
| Molecular Formula | C11H8F4N4O |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[2-(triazol-1-yl)phenyl]propanamide |
| SMILES | O=C(Nc1ccccc1-n1ccnn1)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H8F4N4O/c12-9(13)11(14,15)10(20)17-7-3-1-2-4-8(7)19-6-5-16-18-19/h1-6,9H,(H,17,20) |
| InChIKey | GLFSJQDMEIFCGY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|