C13H14F4N2O2 — CID 103731890
2,2,3,3-tetrafluoro-N-(2-morpholin-4-ylphenyl)propanamide (PubChem CID 103731890) has the molecular formula C13H14F4N2O2 and a molecular weight of 306.26 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-(2-morpholin-4-ylphenyl)propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-(2-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 103731890 |
| Molecular Formula | C13H14F4N2O2 |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-(2-morpholin-4-ylphenyl)propanamide |
| SMILES | O=C(Nc1ccccc1N1CCOCC1)C(F)(F)C(F)F |
| InChI | InChI=1S/C13H14F4N2O2/c14-11(15)13(16,17)12(20)18-9-3-1-2-4-10(9)19-5-7-21-8-6-19/h1-4,11H,5-8H2,(H,18,20) |
| InChIKey | MNYSHPYXRZVJGS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|