C17H19N3O4 — CID 110699962
5-acetamido-N-(2-morpholin-4-ylphenyl)furan-2-carboxamide (PubChem CID 110699962) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is 5-acetamido-N-(2-morpholin-4-ylphenyl)furan-2-carboxamide.
| Compound Name | 5-acetamido-N-(2-morpholin-4-ylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 110699962 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 5-acetamido-N-(2-morpholin-4-ylphenyl)furan-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(C(=O)Nc2ccccc2N2CCOCC2)o1 |
| InChI | InChI=1S/C17H19N3O4/c1-12(21)18-16-7-6-15(24-16)17(22)19-13-4-2-3-5-14(13)20-8-10-23-11-9-20/h2-7H,8-11H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | ILZQDBSARYAEJX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |