C23H24N2O5 — CID 78884002
5-[(2-methoxyphenoxy)methyl]-N-(2-morpholin-4-ylphenyl)furan-2-carboxamide (PubChem CID 78884002) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is 5-[(2-methoxyphenoxy)methyl]-N-(2-morpholin-4-ylphenyl)furan-2-carboxamide.
| Compound Name | 5-[(2-methoxyphenoxy)methyl]-N-(2-morpholin-4-ylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 78884002 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 5-[(2-methoxyphenoxy)methyl]-N-(2-morpholin-4-ylphenyl)furan-2-carboxamide |
| SMILES | COc1ccccc1OCc1ccc(C(=O)Nc2ccccc2N2CCOCC2)o1 |
| InChI | InChI=1S/C23H24N2O5/c1-27-20-8-4-5-9-21(20)29-16-17-10-11-22(30-17)23(26)24-18-6-2-3-7-19(18)25-12-14-28-15-13-25/h2-11H,12-16H2,1H3,(H,24,26) |
| InChIKey | LTYNEHIWTAXGBP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 73.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |