C23H23FN2O4 — CID 56581466
N-(2-fluoro-6-pyrrolidin-1-ylphenyl)-5-[(2-methoxyphenoxy)methyl]furan-2-carboxamide (PubChem CID 56581466) has the molecular formula C23H23FN2O4 and a molecular weight of 410.45 g/mol. Its IUPAC name is N-(2-fluoro-6-pyrrolidin-1-ylphenyl)-5-[(2-methoxyphenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(2-fluoro-6-pyrrolidin-1-ylphenyl)-5-[(2-methoxyphenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 56581466 |
| Molecular Formula | C23H23FN2O4 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | N-(2-fluoro-6-pyrrolidin-1-ylphenyl)-5-[(2-methoxyphenoxy)methyl]furan-2-carboxamide |
| SMILES | COc1ccccc1OCc1ccc(C(=O)Nc2c(F)cccc2N2CCCC2)o1 |
| InChI | InChI=1S/C23H23FN2O4/c1-28-19-9-2-3-10-20(19)29-15-16-11-12-21(30-16)23(27)25-22-17(24)7-6-8-18(22)26-13-4-5-14-26/h2-3,6-12H,4-5,13-15H2,1H3,(H,25,27) |
| InChIKey | UABSFQQBIGWMQI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |