C24H23FN2O2 — CID 56581470
N-(2-fluoro-6-pyrrolidin-1-ylphenyl)-4-(phenoxymethyl)benzamide (PubChem CID 56581470) has the molecular formula C24H23FN2O2 and a molecular weight of 390.46 g/mol. Its IUPAC name is N-(2-fluoro-6-pyrrolidin-1-ylphenyl)-4-(phenoxymethyl)benzamide.
| Compound Name | N-(2-fluoro-6-pyrrolidin-1-ylphenyl)-4-(phenoxymethyl)benzamide |
|---|---|
| PubChem CID | 56581470 |
| Molecular Formula | C24H23FN2O2 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | N-(2-fluoro-6-pyrrolidin-1-ylphenyl)-4-(phenoxymethyl)benzamide |
| SMILES | O=C(Nc1c(F)cccc1N1CCCC1)c1ccc(COc2ccccc2)cc1 |
| InChI | InChI=1S/C24H23FN2O2/c25-21-9-6-10-22(27-15-4-5-16-27)23(21)26-24(28)19-13-11-18(12-14-19)17-29-20-7-2-1-3-8-20/h1-3,6-14H,4-5,15-17H2,(H,26,28) |
| InChIKey | ZDXWTNBNCUVIPF-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |