C25H25N3O3S — CID 1312311
N-[(2-morpholin-4-ylphenyl)carbamothioyl]-4-(phenoxymethyl)benzamide (PubChem CID 1312311) has the molecular formula C25H25N3O3S and a molecular weight of 447.56 g/mol. Its IUPAC name is N-[(2-morpholin-4-ylphenyl)carbamothioyl]-4-(phenoxymethyl)benzamide.
| Compound Name | N-[(2-morpholin-4-ylphenyl)carbamothioyl]-4-(phenoxymethyl)benzamide |
|---|---|
| PubChem CID | 1312311 |
| Molecular Formula | C25H25N3O3S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | N-[(2-morpholin-4-ylphenyl)carbamothioyl]-4-(phenoxymethyl)benzamide |
| SMILES | O=C(NC(=S)Nc1ccccc1N1CCOCC1)c1ccc(COc2ccccc2)cc1 |
| InChI | InChI=1S/C25H25N3O3S/c29-24(20-12-10-19(11-13-20)18-31-21-6-2-1-3-7-21)27-25(32)26-22-8-4-5-9-23(22)28-14-16-30-17-15-28/h1-13H,14-18H2,(H2,26,27,29,32) |
| InChIKey | MNGYZXNTRADXRG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|