C18H20FN3O — CID 119872678
4-(aminomethyl)-N-(2-fluoro-6-pyrrolidin-1-ylphenyl)benzamide (PubChem CID 119872678) has the molecular formula C18H20FN3O and a molecular weight of 313.38 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(2-fluoro-6-pyrrolidin-1-ylphenyl)benzamide.
| Compound Name | 4-(aminomethyl)-N-(2-fluoro-6-pyrrolidin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 119872678 |
| Molecular Formula | C18H20FN3O |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 4-(aminomethyl)-N-(2-fluoro-6-pyrrolidin-1-ylphenyl)benzamide |
| SMILES | NCc1ccc(C(=O)Nc2c(F)cccc2N2CCCC2)cc1 |
| InChI | InChI=1S/C18H20FN3O/c19-15-4-3-5-16(22-10-1-2-11-22)17(15)21-18(23)14-8-6-13(12-20)7-9-14/h3-9H,1-2,10-12,20H2,(H,21,23) |
| InChIKey | XOKPSAZIQOCVHE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |