C15H14F2N4O — CID 109249520
N-(2,6-difluorophenyl)-2-pyrrolidin-1-ylpyrimidine-5-carboxamide (PubChem CID 109249520) has the molecular formula C15H14F2N4O and a molecular weight of 304.30 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2-pyrrolidin-1-ylpyrimidine-5-carboxamide.
| Compound Name | N-(2,6-difluorophenyl)-2-pyrrolidin-1-ylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109249520 |
| Molecular Formula | C15H14F2N4O |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | N-(2,6-difluorophenyl)-2-pyrrolidin-1-ylpyrimidine-5-carboxamide |
| SMILES | O=C(Nc1c(F)cccc1F)c1cnc(N2CCCC2)nc1 |
| InChI | InChI=1S/C15H14F2N4O/c16-11-4-3-5-12(17)13(11)20-14(22)10-8-18-15(19-9-10)21-6-1-2-7-21/h3-5,8-9H,1-2,6-7H2,(H,20,22) |
| InChIKey | XKNDCVHKXMEVTK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |