C13H14F4N2OS — CID 122133653
N-(2-fluoro-6-pyrrolidin-1-ylphenyl)-2-(trifluoromethylsulfanyl)acetamide (PubChem CID 122133653) has the molecular formula C13H14F4N2OS and a molecular weight of 322.33 g/mol. Its IUPAC name is N-(2-fluoro-6-pyrrolidin-1-ylphenyl)-2-(trifluoromethylsulfanyl)acetamide.
| Compound Name | N-(2-fluoro-6-pyrrolidin-1-ylphenyl)-2-(trifluoromethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 122133653 |
| Molecular Formula | C13H14F4N2OS |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | N-(2-fluoro-6-pyrrolidin-1-ylphenyl)-2-(trifluoromethylsulfanyl)acetamide |
| SMILES | O=C(CSC(F)(F)F)Nc1c(F)cccc1N1CCCC1 |
| InChI | InChI=1S/C13H14F4N2OS/c14-9-4-3-5-10(19-6-1-2-7-19)12(9)18-11(20)8-21-13(15,16)17/h3-5H,1-2,6-8H2,(H,18,20) |
| InChIKey | GONDEKTXGIGPQW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |