C21H25FN2O2 — CID 56580441
N-(2-fluoro-6-pyrrolidin-1-ylphenyl)-2-(2,4,6-trimethylphenoxy)acetamide (PubChem CID 56580441) has the molecular formula C21H25FN2O2 and a molecular weight of 356.44 g/mol. Its IUPAC name is N-(2-fluoro-6-pyrrolidin-1-ylphenyl)-2-(2,4,6-trimethylphenoxy)acetamide.
| Compound Name | N-(2-fluoro-6-pyrrolidin-1-ylphenyl)-2-(2,4,6-trimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 56580441 |
| Molecular Formula | C21H25FN2O2 |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | N-(2-fluoro-6-pyrrolidin-1-ylphenyl)-2-(2,4,6-trimethylphenoxy)acetamide |
| SMILES | Cc1cc(C)c(OCC(=O)Nc2c(F)cccc2N2CCCC2)c(C)c1 |
| InChI | InChI=1S/C21H25FN2O2/c1-14-11-15(2)21(16(3)12-14)26-13-19(25)23-20-17(22)7-6-8-18(20)24-9-4-5-10-24/h6-8,11-12H,4-5,9-10,13H2,1-3H3,(H,23,25) |
| InChIKey | UODCZJYMZHOOIU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |