C20H17N5O3S2 — CID 135996154
2-[[2-[(5-cyano-4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]-5-phenylthiophene-3-carboxamide (PubChem CID 135996154) has the molecular formula C20H17N5O3S2 and a molecular weight of 439.52 g/mol. Its IUPAC name is 2-[[2-[(5-cyano-4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]-5-phenylthiophene-3-carboxamide.
| Compound Name | 2-[[2-[(5-cyano-4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]-5-phenylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 135996154 |
| Molecular Formula | C20H17N5O3S2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 2-[[2-[(5-cyano-4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]-5-phenylthiophene-3-carboxamide |
| SMILES | CCc1nc(SCC(=O)Nc2sc(-c3ccccc3)cc2C(N)=O)[nH]c(=O)c1C#N |
| InChI | InChI=1S/C20H17N5O3S2/c1-2-14-13(9-21)18(28)25-20(23-14)29-10-16(26)24-19-12(17(22)27)8-15(30-19)11-6-4-3-5-7-11/h3-8H,2,10H2,1H3,(H2,22,27)(H,24,26)(H,23,25,28) |
| InChIKey | GJZDSGTWJUHYHN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 141.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|