C16H9F3N6O2S2 — CID 135455188
2-[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 135455188) has the molecular formula C16H9F3N6O2S2 and a molecular weight of 438.42 g/mol. Its IUPAC name is 2-[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 135455188 |
| Molecular Formula | C16H9F3N6O2S2 |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | 2-[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | N#Cc1c(-c2ccccc2)nc(SCC(=O)Nc2nnc(C(F)(F)F)s2)[nH]c1=O |
| InChI | InChI=1S/C16H9F3N6O2S2/c17-16(18,19)13-24-25-15(29-13)21-10(26)7-28-14-22-11(8-4-2-1-3-5-8)9(6-20)12(27)23-14/h1-5H,7H2,(H,21,25,26)(H,22,23,27) |
| InChIKey | CQEQGGXCAPZJAB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 124.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|