C17H13N5O3S2 — CID 135541339
2-[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]-N-(5-methyl-4-oxo-1,3-thiazol-2-yl)acetamide (PubChem CID 135541339) has the molecular formula C17H13N5O3S2 and a molecular weight of 399.46 g/mol. Its IUPAC name is 2-[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]-N-(5-methyl-4-oxo-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]-N-(5-methyl-4-oxo-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 135541339 |
| Molecular Formula | C17H13N5O3S2 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 2-[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]-N-(5-methyl-4-oxo-1,3-thiazol-2-yl)acetamide |
| SMILES | CC1SC(NC(=O)CSc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)=NC1=O |
| InChI | InChI=1S/C17H13N5O3S2/c1-9-14(24)21-17(27-9)19-12(23)8-26-16-20-13(10-5-3-2-4-6-10)11(7-18)15(25)22-16/h2-6,9H,8H2,1H3,(H,20,22,25)(H,19,21,23,24) |
| InChIKey | SDNCXFCDYPPBMC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 128.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|