C22H14ClN5O2S2 — CID 155811035
2-[[4-(4-chlorophenyl)-5-cyano-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(4-phenyl-1,3-thiazol-2-yl)acetamide (PubChem CID 155811035) has the molecular formula C22H14ClN5O2S2 and a molecular weight of 479.97 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-5-cyano-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(4-phenyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[[4-(4-chlorophenyl)-5-cyano-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(4-phenyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 155811035 |
| Molecular Formula | C22H14ClN5O2S2 |
| Molecular Weight | 479.97 g/mol |
| Exact Mass | 479.03 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-5-cyano-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(4-phenyl-1,3-thiazol-2-yl)acetamide |
| SMILES | N#Cc1c(-c2ccc(Cl)cc2)nc(SCC(=O)Nc2nc(-c3ccccc3)cs2)[nH]c1=O |
| InChI | InChI=1S/C22H14ClN5O2S2/c23-15-8-6-14(7-9-15)19-16(10-24)20(30)28-22(27-19)32-12-18(29)26-21-25-17(11-31-21)13-4-2-1-3-5-13/h1-9,11H,12H2,(H,25,26,29)(H,27,28,30) |
| InChIKey | RCPGJBXKTLCWPN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.97 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|