C17H14N6O2S3 — CID 135620228
2-[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 135620228) has the molecular formula C17H14N6O2S3 and a molecular weight of 430.54 g/mol. Its IUPAC name is 2-[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 135620228 |
| Molecular Formula | C17H14N6O2S3 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | 2-[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCSc1nnc(NC(=O)CSc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)s1 |
| InChI | InChI=1S/C17H14N6O2S3/c1-2-26-17-23-22-16(28-17)19-12(24)9-27-15-20-13(10-6-4-3-5-7-10)11(8-18)14(25)21-15/h3-7H,2,9H2,1H3,(H,19,22,24)(H,20,21,25) |
| InChIKey | NCYZWDOOJWAOAF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 124.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|